C21H23F2N3O2 — CID 24953782
3-(2,4-difluorophenyl)-N-(3,3-dimethyl-2-oxobutyl)-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carboxamide (PubChem CID 24953782) has the molecular formula C21H23F2N3O2 and a molecular weight of 387.43 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-N-(3,3-dimethyl-2-oxobutyl)-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carboxamide.
| Compound Name | 3-(2,4-difluorophenyl)-N-(3,3-dimethyl-2-oxobutyl)-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carboxamide |
|---|---|
| PubChem CID | 24953782 |
| Molecular Formula | C21H23F2N3O2 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 3-(2,4-difluorophenyl)-N-(3,3-dimethyl-2-oxobutyl)-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carboxamide |
| SMILES | CC(C)(C)C(=O)CNC(=O)c1nn(-c2ccc(F)cc2F)c2c1C1CCC2C1 |
| InChI | InChI=1S/C21H23F2N3O2/c1-21(2,3)16(27)10-24-20(28)18-17-11-4-5-12(8-11)19(17)26(25-18)15-7-6-13(22)9-14(15)23/h6-7,9,11-12H,4-5,8,10H2,1-3H3,(H,24,28) |
| InChIKey | QGIQEOAUZRUVOT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |