C22H16N2O4S — CID 24953841
3-[2-[5-[(methyl-oxo-phenyl-λ6-sulfanylidene)carbamoyl]-3-pyridinyl]ethynyl]benzoic acid (PubChem CID 24953841) has the molecular formula C22H16N2O4S and a molecular weight of 404.45 g/mol. Its IUPAC name is 3-[2-[5-[(methyl-oxo-phenyl-λ6-sulfanylidene)carbamoyl]-3-pyridinyl]ethynyl]benzoic acid.
| Compound Name | 3-[2-[5-[(methyl-oxo-phenyl-λ6-sulfanylidene)carbamoyl]-3-pyridinyl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 24953841 |
| Molecular Formula | C22H16N2O4S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 3-[2-[5-[(methyl-oxo-phenyl-λ6-sulfanylidene)carbamoyl]-3-pyridinyl]ethynyl]benzoic acid |
| SMILES | C[S@@](=O)(=NC(=O)c1cncc(C#Cc2cccc(C(=O)O)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C22H16N2O4S/c1-29(28,20-8-3-2-4-9-20)24-21(25)19-13-17(14-23-15-19)11-10-16-6-5-7-18(12-16)22(26)27/h2-9,12-15H,1H3,(H,26,27)/t29-/m0/s1 |
| InChIKey | VYFPKPWVACWURF-LJAQVGFWSA-N |
| XLogP | 3.48 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|