C24H30N4O — CID 24954196
3-[5-(4-tert-butylphenyl)-3-[(1-methylpyrrolidin-1-ium-1-yl)methyl]-1,2,4-triazol-1-yl]phenolate (PubChem CID 24954196) has the molecular formula C24H30N4O and a molecular weight of 390.53 g/mol. Its IUPAC name is 3-[5-(4-tert-butylphenyl)-3-[(1-methylpyrrolidin-1-ium-1-yl)methyl]-1,2,4-triazol-1-yl]phenolate.
| Compound Name | 3-[5-(4-tert-butylphenyl)-3-[(1-methylpyrrolidin-1-ium-1-yl)methyl]-1,2,4-triazol-1-yl]phenolate |
|---|---|
| PubChem CID | 24954196 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 3-[5-(4-tert-butylphenyl)-3-[(1-methylpyrrolidin-1-ium-1-yl)methyl]-1,2,4-triazol-1-yl]phenolate |
| SMILES | CC(C)(C)c1ccc(-c2nc(C[N+]3(C)CCCC3)nn2-c2cccc([O-])c2)cc1 |
| InChI | InChI=1S/C24H30N4O/c1-24(2,3)19-12-10-18(11-13-19)23-25-22(17-28(4)14-5-6-15-28)26-27(23)20-8-7-9-21(29)16-20/h7-13,16H,5-6,14-15,17H2,1-4H3 |
| InChIKey | XFHNSBWZTIEYRI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 53.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|