C24H29F2N3O2 — CID 24954481
3-(2,4-difluorophenyl)-N-(3,3-dimethyl-2-oxobutyl)-1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carboxamide (PubChem CID 24954481) has the molecular formula C24H29F2N3O2 and a molecular weight of 429.51 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-N-(3,3-dimethyl-2-oxobutyl)-1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carboxamide.
| Compound Name | 3-(2,4-difluorophenyl)-N-(3,3-dimethyl-2-oxobutyl)-1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carboxamide |
|---|---|
| PubChem CID | 24954481 |
| Molecular Formula | C24H29F2N3O2 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 3-(2,4-difluorophenyl)-N-(3,3-dimethyl-2-oxobutyl)-1,10,10-trimethyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carboxamide |
| SMILES | CC(C)(C)C(=O)CNC(=O)c1nn(-c2ccc(F)cc2F)c2c1C1CCC2(C)C1(C)C |
| InChI | InChI=1S/C24H29F2N3O2/c1-22(2,3)17(30)12-27-21(31)19-18-14-9-10-24(6,23(14,4)5)20(18)29(28-19)16-8-7-13(25)11-15(16)26/h7-8,11,14H,9-10,12H2,1-6H3,(H,27,31) |
| InChIKey | LXKQCSAGWRVKGG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |