C22H31N5O3 — CID 24954515
1-[(E)-(7-methyl-2,3-dihydrochromen-4-ylidene)amino]-3-[4-(4-methylpiperazin-1-yl)butyl]imidazolidine-2,4-dione (PubChem CID 24954515) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is 1-[(E)-(7-methyl-2,3-dihydrochromen-4-ylidene)amino]-3-[4-(4-methylpiperazin-1-yl)butyl]imidazolidine-2,4-dione.
| Compound Name | 1-[(E)-(7-methyl-2,3-dihydrochromen-4-ylidene)amino]-3-[4-(4-methylpiperazin-1-yl)butyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24954515 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 1-[(E)-(7-methyl-2,3-dihydrochromen-4-ylidene)amino]-3-[4-(4-methylpiperazin-1-yl)butyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc2c(c1)OCC/C2=N\N1CC(=O)N(CCCCN2CCN(C)CC2)C1=O |
| InChI | InChI=1S/C22H31N5O3/c1-17-5-6-18-19(7-14-30-20(18)15-17)23-27-16-21(28)26(22(27)29)9-4-3-8-25-12-10-24(2)11-13-25/h5-6,15H,3-4,7-14,16H2,1-2H3/b23-19+ |
| InChIKey | MYWVGUFQQLBPNY-FCDQGJHFSA-N |
| XLogP | 1.77 |
| TPSA | 68.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|