C14H14N2O5 — CID 24954572
5-ethyl-2-(5-hydroxypent-2-ynoxy)-3H-pyrano[2,3-d]pyrimidine-4,7-dione (PubChem CID 24954572) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is 5-ethyl-2-(5-hydroxypent-2-ynoxy)-3H-pyrano[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-ethyl-2-(5-hydroxypent-2-ynoxy)-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 24954572 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 5-ethyl-2-(5-hydroxypent-2-ynoxy)-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
| SMILES | CCc1cc(=O)oc2nc(OCC#CCCO)[nH]c(=O)c12 |
| InChI | InChI=1S/C14H14N2O5/c1-2-9-8-10(18)21-13-11(9)12(19)15-14(16-13)20-7-5-3-4-6-17/h8,17H,2,4,6-7H2,1H3,(H,15,16,19) |
| InChIKey | QXYQGNQCGMRZCT-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|