C24H30N8 — CID 24954590
N,N'-bis[5-[4-(dimethylamino)phenyl]-1H-pyrazol-3-yl]ethane-1,2-diamine (PubChem CID 24954590) has the molecular formula C24H30N8 and a molecular weight of 430.56 g/mol. Its IUPAC name is N,N'-bis[5-[4-(dimethylamino)phenyl]-1H-pyrazol-3-yl]ethane-1,2-diamine.
| Compound Name | N,N'-bis[5-[4-(dimethylamino)phenyl]-1H-pyrazol-3-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 24954590 |
| Molecular Formula | C24H30N8 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | N,N'-bis[5-[4-(dimethylamino)phenyl]-1H-pyrazol-3-yl]ethane-1,2-diamine |
| SMILES | CN(C)c1ccc(-c2cc(NCCNc3cc(-c4ccc(N(C)C)cc4)[nH]n3)n[nH]2)cc1 |
| InChI | InChI=1S/C24H30N8/c1-31(2)19-9-5-17(6-10-19)21-15-23(29-27-21)25-13-14-26-24-16-22(28-30-24)18-7-11-20(12-8-18)32(3)4/h5-12,15-16H,13-14H2,1-4H3,(H2,25,27,29)(H2,26,28,30) |
| InChIKey | VKXHTNNQVMZTTQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|