About (2Z)-2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-(2-fluorophenyl)ethanone
(2Z)-2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-(2-fluorophenyl)ethanone (PubChem CID 24954630) has the molecular formula C17H20FNOS
and a molecular weight of 305.42 g/mol. Its IUPAC name is (2Z)-2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-(2-fluorophenyl)ethanone.
Molecular Properties
| Compound Name | (2Z)-2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-(2-fluorophenyl)ethanone |
| PubChem CID | 24954630 |
| Molecular Formula | C17H20FNOS |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | (2Z)-2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-(2-fluorophenyl)ethanone |
| SMILES | CCCCN1C(C)=C(C)S/C1=C\C(=O)c1ccccc1F |
| InChI | InChI=1S/C17H20FNOS/c1-4-5-10-19-12(2)13(3)21-17(19)11-16(20)14-8-6-7-9-15(14)18/h6-9,11H,4-5,10H2,1-3H3/b17-11- |
| InChIKey | NONPZYYHUAVXQN-BOPFTXTBSA-N |
| XLogP | 4.95 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-(2-fluorophenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-(2-fluorophenyl)ethanone?
The IUPAC name of (2Z)-2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-(2-fluorophenyl)ethanone (CID 24954630) is (2Z)-2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-(2-fluorophenyl)ethanone.
What is the SMILES notation for (2Z)-2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-(2-fluorophenyl)ethanone?
The canonical SMILES for (2Z)-2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-(2-fluorophenyl)ethanone is CCCCN1C(C)=C(C)S/C1=C\C(=O)c1ccccc1F.
What is the InChIKey of (2Z)-2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-(2-fluorophenyl)ethanone?
The InChIKey is NONPZYYHUAVXQN-BOPFTXTBSA-N. The full InChI is InChI=1S/C17H20FNOS/c1-4-5-10-19-12(2)13(3)21-17(19)11-16(20)14-8-6-7-9-15(14)18/h6-9,11H,4-5,10H2,1-3H3/b17-11-.
What are the key properties of (2Z)-2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-(2-fluorophenyl)ethanone?
(2Z)-2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-(2-fluorophenyl)ethanone has a molecular weight of 305.42 g/mol, XLogP of 4.95, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-(2-fluorophenyl)ethanone is sourced from PubChem (CID 24954630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).