C17H19F2NOS — CID 24954632
(2Z)-2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-(3,5-difluorophenyl)ethanone (PubChem CID 24954632) has the molecular formula C17H19F2NOS and a molecular weight of 323.41 g/mol. Its IUPAC name is (2Z)-2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-(3,5-difluorophenyl)ethanone.
| Compound Name | (2Z)-2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-(3,5-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 24954632 |
| Molecular Formula | C17H19F2NOS |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (2Z)-2-(3-butyl-4,5-dimethyl-1,3-thiazol-2-ylidene)-1-(3,5-difluorophenyl)ethanone |
| SMILES | CCCCN1C(C)=C(C)S/C1=C\C(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H19F2NOS/c1-4-5-6-20-11(2)12(3)22-17(20)10-16(21)13-7-14(18)9-15(19)8-13/h7-10H,4-6H2,1-3H3/b17-10- |
| InChIKey | FZPQDIUOWZBLDG-YVLHZVERSA-N |
| XLogP | 5.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|