C25H28N2O — CID 24954832
N-[(1S)-3-(dimethylamino)-1-(4-methylphenyl)propyl]-4-phenylbenzamide (PubChem CID 24954832) has the molecular formula C25H28N2O and a molecular weight of 372.51 g/mol. Its IUPAC name is N-[(1S)-3-(dimethylamino)-1-(4-methylphenyl)propyl]-4-phenylbenzamide.
| Compound Name | N-[(1S)-3-(dimethylamino)-1-(4-methylphenyl)propyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 24954832 |
| Molecular Formula | C25H28N2O |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | N-[(1S)-3-(dimethylamino)-1-(4-methylphenyl)propyl]-4-phenylbenzamide |
| SMILES | Cc1ccc([C@H](CCN(C)C)NC(=O)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H28N2O/c1-19-9-11-22(12-10-19)24(17-18-27(2)3)26-25(28)23-15-13-21(14-16-23)20-7-5-4-6-8-20/h4-16,24H,17-18H2,1-3H3,(H,26,28)/t24-/m0/s1 |
| InChIKey | PKZUKNKGFLPJNY-DEOSSOPVSA-N |
| XLogP | 5.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |