C14H14F3N3O2 — CID 24954992
N-[2-[4-(trifluoromethyl)-10-oxa-5,6-diazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-3-yl]ethyl]acetamide (PubChem CID 24954992) has the molecular formula C14H14F3N3O2 and a molecular weight of 313.28 g/mol. Its IUPAC name is N-[2-[4-(trifluoromethyl)-10-oxa-5,6-diazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-3-yl]ethyl]acetamide.
| Compound Name | N-[2-[4-(trifluoromethyl)-10-oxa-5,6-diazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 24954992 |
| Molecular Formula | C14H14F3N3O2 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | N-[2-[4-(trifluoromethyl)-10-oxa-5,6-diazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7-tetraen-3-yl]ethyl]acetamide |
| SMILES | CC(=O)NCCc1c(C(F)(F)F)nn2ccc3c(c12)CCO3 |
| InChI | InChI=1S/C14H14F3N3O2/c1-8(21)18-5-2-10-12-9-4-7-22-11(9)3-6-20(12)19-13(10)14(15,16)17/h3,6H,2,4-5,7H2,1H3,(H,18,21) |
| InChIKey | PKOBNGSYRZCTGZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |