C40H61N2OP — CID 24955029
cyclohexyl-[(4R,5R)-4,5-dicyclohexyl-2-(2-dicyclohexylphosphanylphenyl)-4,5-dihydroimidazol-1-yl]methanone (PubChem CID 24955029) has the molecular formula C40H61N2OP and a molecular weight of 616.92 g/mol. Its IUPAC name is cyclohexyl-[(4R,5R)-4,5-dicyclohexyl-2-(2-dicyclohexylphosphanylphenyl)-4,5-dihydroimidazol-1-yl]methanone.
| Compound Name | cyclohexyl-[(4R,5R)-4,5-dicyclohexyl-2-(2-dicyclohexylphosphanylphenyl)-4,5-dihydroimidazol-1-yl]methanone |
|---|---|
| PubChem CID | 24955029 |
| Molecular Formula | C40H61N2OP |
| Molecular Weight | 616.92 g/mol |
| Exact Mass | 616.45 |
| IUPAC Name | cyclohexyl-[(4R,5R)-4,5-dicyclohexyl-2-(2-dicyclohexylphosphanylphenyl)-4,5-dihydroimidazol-1-yl]methanone |
| SMILES | O=C(C1CCCCC1)N1C(c2ccccc2P(C2CCCCC2)C2CCCCC2)=N[C@H](C2CCCCC2)[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C40H61N2OP/c43-40(32-22-10-3-11-23-32)42-38(31-20-8-2-9-21-31)37(30-18-6-1-7-19-30)41-39(42)35-28-16-17-29-36(35)44(33-24-12-4-13-25-33)34-26-14-5-15-27-34/h16-17,28-34,37-38H,1-15,18-27H2/t37-,38-/m1/s1 |
| InChIKey | IJZCNIFWZXYFAW-XPSQVAKYSA-N |
| XLogP | 10.53 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.92 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|