About 5-butyl-2-(difluoromethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione
5-butyl-2-(difluoromethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione (PubChem CID 24955288) has the molecular formula C12H12F2N2O3
and a molecular weight of 270.23 g/mol. Its IUPAC name is 5-butyl-2-(difluoromethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione.
Molecular Properties
| Compound Name | 5-butyl-2-(difluoromethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
| PubChem CID | 24955288 |
| Molecular Formula | C12H12F2N2O3 |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 5-butyl-2-(difluoromethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
| SMILES | CCCCc1cc(=O)oc2nc(C(F)F)[nH]c(=O)c12 |
| InChI | InChI=1S/C12H12F2N2O3/c1-2-3-4-6-5-7(17)19-12-8(6)11(18)15-10(16-12)9(13)14/h5,9H,2-4H2,1H3,(H,15,16,18) |
| InChIKey | YYCZNFQDNBAXBU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-butyl-2-(difluoromethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-2-(difluoromethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione?
The IUPAC name of 5-butyl-2-(difluoromethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione (CID 24955288) is 5-butyl-2-(difluoromethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione.
What is the SMILES notation for 5-butyl-2-(difluoromethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione?
The canonical SMILES for 5-butyl-2-(difluoromethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione is CCCCc1cc(=O)oc2nc(C(F)F)[nH]c(=O)c12.
What is the InChIKey of 5-butyl-2-(difluoromethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione?
The InChIKey is YYCZNFQDNBAXBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F2N2O3/c1-2-3-4-6-5-7(17)19-12-8(6)11(18)15-10(16-12)9(13)14/h5,9H,2-4H2,1H3,(H,15,16,18).
What are the key properties of 5-butyl-2-(difluoromethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione?
5-butyl-2-(difluoromethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione has a molecular weight of 270.23 g/mol, XLogP of 2.16, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-2-(difluoromethyl)-3H-pyrano[2,3-d]pyrimidine-4,7-dione is sourced from PubChem (CID 24955288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).