C15H29NOS — CID 24955510
(1R,2S,5R)-5-methyl-N-(3-methylsulfanylpropyl)-2-propan-2-ylcyclohexane-1-carboxamide (PubChem CID 24955510) has the molecular formula C15H29NOS and a molecular weight of 271.47 g/mol. Its IUPAC name is (1R,2S,5R)-5-methyl-N-(3-methylsulfanylpropyl)-2-propan-2-ylcyclohexane-1-carboxamide.
| Compound Name | (1R,2S,5R)-5-methyl-N-(3-methylsulfanylpropyl)-2-propan-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 24955510 |
| Molecular Formula | C15H29NOS |
| Molecular Weight | 271.47 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | (1R,2S,5R)-5-methyl-N-(3-methylsulfanylpropyl)-2-propan-2-ylcyclohexane-1-carboxamide |
| SMILES | CSCCCNC(=O)[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C15H29NOS/c1-11(2)13-7-6-12(3)10-14(13)15(17)16-8-5-9-18-4/h11-14H,5-10H2,1-4H3,(H,16,17)/t12-,13+,14-/m1/s1 |
| InChIKey | ODBLKDJCZFZNAZ-HZSPNIEDSA-N |
| XLogP | 3.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|