C25H21NO7 — CID 24956202
(2S,3R,4S,4aR)-2,3,4-trihydroxy-7-(naphthalen-2-ylmethoxy)-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-6-one (PubChem CID 24956202) has the molecular formula C25H21NO7 and a molecular weight of 447.44 g/mol. Its IUPAC name is (2S,3R,4S,4aR)-2,3,4-trihydroxy-7-(naphthalen-2-ylmethoxy)-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-6-one.
| Compound Name | (2S,3R,4S,4aR)-2,3,4-trihydroxy-7-(naphthalen-2-ylmethoxy)-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-6-one |
|---|---|
| PubChem CID | 24956202 |
| Molecular Formula | C25H21NO7 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | (2S,3R,4S,4aR)-2,3,4-trihydroxy-7-(naphthalen-2-ylmethoxy)-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-6-one |
| SMILES | O=C1N[C@@H]2C(=C[C@H](O)[C@@H](O)[C@H]2O)c2cc3c(c(OCc4ccc5ccccc5c4)c21)OCO3 |
| InChI | InChI=1S/C25H21NO7/c27-17-8-16-15-9-18-23(33-11-32-18)24(19(15)25(30)26-20(16)22(29)21(17)28)31-10-12-5-6-13-3-1-2-4-14(13)7-12/h1-9,17,20-22,27-29H,10-11H2,(H,26,30)/t17-,20+,21+,22-/m0/s1 |
| InChIKey | XHESYQAENZTTEW-UPZYVNNASA-N |
| XLogP | 1.74 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |