C18H17NO9 — CID 24956203
[(2S,3S,4S,4aR)-7-acetyloxy-3,4-dihydroxy-6-oxo-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-2-yl] acetate (PubChem CID 24956203) has the molecular formula C18H17NO9 and a molecular weight of 391.33 g/mol. Its IUPAC name is [(2S,3S,4S,4aR)-7-acetyloxy-3,4-dihydroxy-6-oxo-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-2-yl] acetate.
| Compound Name | [(2S,3S,4S,4aR)-7-acetyloxy-3,4-dihydroxy-6-oxo-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-2-yl] acetate |
|---|---|
| PubChem CID | 24956203 |
| Molecular Formula | C18H17NO9 |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | [(2S,3S,4S,4aR)-7-acetyloxy-3,4-dihydroxy-6-oxo-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-2-yl] acetate |
| SMILES | CC(=O)Oc1c2c(cc3c1C(=O)N[C@@H]1C3=C[C@H](OC(C)=O)[C@@H](O)[C@H]1O)OCO2 |
| InChI | InChI=1S/C18H17NO9/c1-6(20)27-10-4-9-8-3-11-16(26-5-25-11)17(28-7(2)21)12(8)18(24)19-13(9)15(23)14(10)22/h3-4,10,13-15,22-23H,5H2,1-2H3,(H,19,24)/t10-,13+,14+,15-/m0/s1 |
| InChIKey | IRLZGCUKZMNHMI-QOWREQOWSA-N |
| XLogP | -0.50 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|