C21H17NO8 — CID 24956204
[(2S,3S,4S,4aR)-3,4,7-trihydroxy-6-oxo-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-2-yl] benzoate (PubChem CID 24956204) has the molecular formula C21H17NO8 and a molecular weight of 411.37 g/mol. Its IUPAC name is [(2S,3S,4S,4aR)-3,4,7-trihydroxy-6-oxo-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-2-yl] benzoate.
| Compound Name | [(2S,3S,4S,4aR)-3,4,7-trihydroxy-6-oxo-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-2-yl] benzoate |
|---|---|
| PubChem CID | 24956204 |
| Molecular Formula | C21H17NO8 |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | [(2S,3S,4S,4aR)-3,4,7-trihydroxy-6-oxo-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-2-yl] benzoate |
| SMILES | O=C(O[C@H]1C=C2c3cc4c(c(O)c3C(=O)N[C@H]2[C@H](O)[C@@H]1O)OCO4)c1ccccc1 |
| InChI | InChI=1S/C21H17NO8/c23-16-12(30-21(27)9-4-2-1-3-5-9)7-11-10-6-13-19(29-8-28-13)17(24)14(10)20(26)22-15(11)18(16)25/h1-7,12,15-16,18,23-25H,8H2,(H,22,26)/t12-,15+,16+,18-/m0/s1 |
| InChIKey | MRSMQYACHHMIGZ-UOQGXUADSA-N |
| XLogP | 0.58 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |