C18H19NO8 — CID 24956205
[(2S,3S,4S,4aR)-3,4,7-trihydroxy-6-oxo-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-2-yl] 2-methylpropanoate (PubChem CID 24956205) has the molecular formula C18H19NO8 and a molecular weight of 377.35 g/mol. Its IUPAC name is [(2S,3S,4S,4aR)-3,4,7-trihydroxy-6-oxo-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-2-yl] 2-methylpropanoate.
| Compound Name | [(2S,3S,4S,4aR)-3,4,7-trihydroxy-6-oxo-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-2-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 24956205 |
| Molecular Formula | C18H19NO8 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | [(2S,3S,4S,4aR)-3,4,7-trihydroxy-6-oxo-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-2-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)O[C@H]1C=C2c3cc4c(c(O)c3C(=O)N[C@H]2[C@H](O)[C@@H]1O)OCO4 |
| InChI | InChI=1S/C18H19NO8/c1-6(2)18(24)27-9-4-8-7-3-10-16(26-5-25-10)14(21)11(7)17(23)19-12(8)15(22)13(9)20/h3-4,6,9,12-13,15,20-22H,5H2,1-2H3,(H,19,23)/t9-,12+,13+,15-/m0/s1 |
| InChIKey | QACXMFNNKCELIO-FWHFQCOYSA-N |
| XLogP | -0.08 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |