About 1-[3,4-dimethyl-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazol-5-yl]ethanone
1-[3,4-dimethyl-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazol-5-yl]ethanone (PubChem CID 24956846) has the molecular formula C14H13F3N2OS
and a molecular weight of 314.33 g/mol. Its IUPAC name is 1-[3,4-dimethyl-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazol-5-yl]ethanone.
Molecular Properties
| Compound Name | 1-[3,4-dimethyl-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazol-5-yl]ethanone |
| PubChem CID | 24956846 |
| Molecular Formula | C14H13F3N2OS |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 1-[3,4-dimethyl-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazol-5-yl]ethanone |
| SMILES | CC(=O)c1s/c(=N\c2ccc(C(F)(F)F)cc2)n(C)c1C |
| InChI | InChI=1S/C14H13F3N2OS/c1-8-12(9(2)20)21-13(19(8)3)18-11-6-4-10(5-7-11)14(15,16)17/h4-7H,1-3H3/b18-13- |
| InChIKey | LEIIAJCWQVPVFY-AQTBWJFISA-N |
| XLogP | 3.85 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|
Analyze 1-[3,4-dimethyl-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazol-5-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,4-dimethyl-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazol-5-yl]ethanone?
The IUPAC name of 1-[3,4-dimethyl-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazol-5-yl]ethanone (CID 24956846) is 1-[3,4-dimethyl-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazol-5-yl]ethanone.
What is the SMILES notation for 1-[3,4-dimethyl-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazol-5-yl]ethanone?
The canonical SMILES for 1-[3,4-dimethyl-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazol-5-yl]ethanone is CC(=O)c1s/c(=N\c2ccc(C(F)(F)F)cc2)n(C)c1C.
What is the InChIKey of 1-[3,4-dimethyl-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazol-5-yl]ethanone?
The InChIKey is LEIIAJCWQVPVFY-AQTBWJFISA-N. The full InChI is InChI=1S/C14H13F3N2OS/c1-8-12(9(2)20)21-13(19(8)3)18-11-6-4-10(5-7-11)14(15,16)17/h4-7H,1-3H3/b18-13-.
What are the key properties of 1-[3,4-dimethyl-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazol-5-yl]ethanone?
1-[3,4-dimethyl-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazol-5-yl]ethanone has a molecular weight of 314.33 g/mol, XLogP of 3.85, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,4-dimethyl-2-[4-(trifluoromethyl)phenyl]imino-1,3-thiazol-5-yl]ethanone is sourced from PubChem (CID 24956846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).