C28H21NO9 — CID 24956921
[(2S,3S,4S,4aR)-7-benzoyloxy-3,4-dihydroxy-6-oxo-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-2-yl] benzoate (PubChem CID 24956921) has the molecular formula C28H21NO9 and a molecular weight of 515.47 g/mol. Its IUPAC name is [(2S,3S,4S,4aR)-7-benzoyloxy-3,4-dihydroxy-6-oxo-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-2-yl] benzoate.
| Compound Name | [(2S,3S,4S,4aR)-7-benzoyloxy-3,4-dihydroxy-6-oxo-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-2-yl] benzoate |
|---|---|
| PubChem CID | 24956921 |
| Molecular Formula | C28H21NO9 |
| Molecular Weight | 515.47 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | [(2S,3S,4S,4aR)-7-benzoyloxy-3,4-dihydroxy-6-oxo-3,4,4a,5-tetrahydro-2H-[1,3]dioxolo[4,5-j]phenanthridin-2-yl] benzoate |
| SMILES | O=C(Oc1c2c(cc3c1C(=O)N[C@@H]1C3=C[C@H](OC(=O)c3ccccc3)[C@@H](O)[C@H]1O)OCO2)c1ccccc1 |
| InChI | InChI=1S/C28H21NO9/c30-22-18(37-27(33)14-7-3-1-4-8-14)12-17-16-11-19-24(36-13-35-19)25(20(16)26(32)29-21(17)23(22)31)38-28(34)15-9-5-2-6-10-15/h1-12,18,21-23,30-31H,13H2,(H,29,32)/t18-,21+,22+,23-/m0/s1 |
| InChIKey | SHYATGLZAWTQBW-MKWLTTDUSA-N |
| XLogP | 2.09 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.47 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|