C24H27N3O5S — CID 24956943
(2S)-2-(benzylamino)-N-hydroxy-3-[4-(4-methylphenoxy)-N-methylsulfonylanilino]propanamide (PubChem CID 24956943) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is (2S)-2-(benzylamino)-N-hydroxy-3-[4-(4-methylphenoxy)-N-methylsulfonylanilino]propanamide.
| Compound Name | (2S)-2-(benzylamino)-N-hydroxy-3-[4-(4-methylphenoxy)-N-methylsulfonylanilino]propanamide |
|---|---|
| PubChem CID | 24956943 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | (2S)-2-(benzylamino)-N-hydroxy-3-[4-(4-methylphenoxy)-N-methylsulfonylanilino]propanamide |
| SMILES | Cc1ccc(Oc2ccc(N(C[C@H](NCc3ccccc3)C(=O)NO)S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C24H27N3O5S/c1-18-8-12-21(13-9-18)32-22-14-10-20(11-15-22)27(33(2,30)31)17-23(24(28)26-29)25-16-19-6-4-3-5-7-19/h3-15,23,25,29H,16-17H2,1-2H3,(H,26,28)/t23-/m0/s1 |
| InChIKey | SJARSEBFYXSCRJ-QHCPKHFHSA-N |
| XLogP | 3.22 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|