C23H23F2N3O3 — CID 24957000
ethyl 2-[2-[(1R,7R)-3-(2,4-difluorophenyl)-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-5-yl]-1,3-oxazol-5-yl]-2-methylpropanoate (PubChem CID 24957000) has the molecular formula C23H23F2N3O3 and a molecular weight of 427.45 g/mol. Its IUPAC name is ethyl 2-[2-[(1R,7R)-3-(2,4-difluorophenyl)-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-5-yl]-1,3-oxazol-5-yl]-2-methylpropanoate.
| Compound Name | ethyl 2-[2-[(1R,7R)-3-(2,4-difluorophenyl)-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-5-yl]-1,3-oxazol-5-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 24957000 |
| Molecular Formula | C23H23F2N3O3 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | ethyl 2-[2-[(1R,7R)-3-(2,4-difluorophenyl)-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-5-yl]-1,3-oxazol-5-yl]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)c1cnc(-c2nn(-c3ccc(F)cc3F)c3c2[C@@H]2CC[C@@H]3C2)o1 |
| InChI | InChI=1S/C23H23F2N3O3/c1-4-30-22(29)23(2,3)17-11-26-21(31-17)19-18-12-5-6-13(9-12)20(18)28(27-19)16-8-7-14(24)10-15(16)25/h7-8,10-13H,4-6,9H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | FTQLTQLPUDHQHR-CHWSQXEVSA-N |
| XLogP | 5.01 |
| TPSA | 70.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |