C18H18N2O5 — CID 24957079
5-butyl-3-phenylmethoxy-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 24957079) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is 5-butyl-3-phenylmethoxy-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 5-butyl-3-phenylmethoxy-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 24957079 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 5-butyl-3-phenylmethoxy-1H-pyrano[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | CCCCc1cc(=O)oc2[nH]c(=O)n(OCc3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C18H18N2O5/c1-2-3-9-13-10-14(21)25-16-15(13)17(22)20(18(23)19-16)24-11-12-7-5-4-6-8-12/h4-8,10H,2-3,9,11H2,1H3,(H,19,23) |
| InChIKey | AYPSBMVBCVPQBL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |