About 3-(4-hydroxy-3,5-dimethylphenyl)-6,8-dimethoxy-2-methylisoquinolin-1-one
3-(4-hydroxy-3,5-dimethylphenyl)-6,8-dimethoxy-2-methylisoquinolin-1-one (PubChem CID 24957481) has the molecular formula C20H21NO4
and a molecular weight of 339.39 g/mol. Its IUPAC name is 3-(4-hydroxy-3,5-dimethylphenyl)-6,8-dimethoxy-2-methylisoquinolin-1-one.
Molecular Properties
| Compound Name | 3-(4-hydroxy-3,5-dimethylphenyl)-6,8-dimethoxy-2-methylisoquinolin-1-one |
| PubChem CID | 24957481 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 3-(4-hydroxy-3,5-dimethylphenyl)-6,8-dimethoxy-2-methylisoquinolin-1-one |
| SMILES | COc1cc(OC)c2c(=O)n(C)c(-c3cc(C)c(O)c(C)c3)cc2c1 |
| InChI | InChI=1S/C20H21NO4/c1-11-6-13(7-12(2)19(11)22)16-9-14-8-15(24-4)10-17(25-5)18(14)20(23)21(16)3/h6-10,22H,1-5H3 |
| InChIKey | DQYUTATUXSOKCS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4-hydroxy-3,5-dimethylphenyl)-6,8-dimethoxy-2-methylisoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-hydroxy-3,5-dimethylphenyl)-6,8-dimethoxy-2-methylisoquinolin-1-one?
The IUPAC name of 3-(4-hydroxy-3,5-dimethylphenyl)-6,8-dimethoxy-2-methylisoquinolin-1-one (CID 24957481) is 3-(4-hydroxy-3,5-dimethylphenyl)-6,8-dimethoxy-2-methylisoquinolin-1-one.
What is the SMILES notation for 3-(4-hydroxy-3,5-dimethylphenyl)-6,8-dimethoxy-2-methylisoquinolin-1-one?
The canonical SMILES for 3-(4-hydroxy-3,5-dimethylphenyl)-6,8-dimethoxy-2-methylisoquinolin-1-one is COc1cc(OC)c2c(=O)n(C)c(-c3cc(C)c(O)c(C)c3)cc2c1.
What is the InChIKey of 3-(4-hydroxy-3,5-dimethylphenyl)-6,8-dimethoxy-2-methylisoquinolin-1-one?
The InChIKey is DQYUTATUXSOKCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO4/c1-11-6-13(7-12(2)19(11)22)16-9-14-8-15(24-4)10-17(25-5)18(14)20(23)21(16)3/h6-10,22H,1-5H3.
What are the key properties of 3-(4-hydroxy-3,5-dimethylphenyl)-6,8-dimethoxy-2-methylisoquinolin-1-one?
3-(4-hydroxy-3,5-dimethylphenyl)-6,8-dimethoxy-2-methylisoquinolin-1-one has a molecular weight of 339.39 g/mol, XLogP of 3.55, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-hydroxy-3,5-dimethylphenyl)-6,8-dimethoxy-2-methylisoquinolin-1-one is sourced from PubChem (CID 24957481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).