C27H21F4N3O — CID 24957615
1-(1-but-3-enylindol-3-yl)-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanol (PubChem CID 24957615) has the molecular formula C27H21F4N3O and a molecular weight of 479.48 g/mol. Its IUPAC name is 1-(1-but-3-enylindol-3-yl)-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanol.
| Compound Name | 1-(1-but-3-enylindol-3-yl)-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanol |
|---|---|
| PubChem CID | 24957615 |
| Molecular Formula | C27H21F4N3O |
| Molecular Weight | 479.48 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 1-(1-but-3-enylindol-3-yl)-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanol |
| SMILES | C=CCCn1cc(C(O)(c2ccc3c(cnn3-c3ccc(F)cc3)c2)C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C27H21F4N3O/c1-2-3-14-33-17-23(22-6-4-5-7-25(22)33)26(35,27(29,30)31)19-8-13-24-18(15-19)16-32-34(24)21-11-9-20(28)10-12-21/h2,4-13,15-17,35H,1,3,14H2 |
| InChIKey | ZYTMCZHHLQPZKA-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 42.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.48 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|