C30H26F4N4O — CID 24957616
2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-(1-prop-2-enyl-6-pyrrolidin-1-ylindol-3-yl)ethanol (PubChem CID 24957616) has the molecular formula C30H26F4N4O and a molecular weight of 534.56 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-(1-prop-2-enyl-6-pyrrolidin-1-ylindol-3-yl)ethanol.
| Compound Name | 2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-(1-prop-2-enyl-6-pyrrolidin-1-ylindol-3-yl)ethanol |
|---|---|
| PubChem CID | 24957616 |
| Molecular Formula | C30H26F4N4O |
| Molecular Weight | 534.56 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-(1-prop-2-enyl-6-pyrrolidin-1-ylindol-3-yl)ethanol |
| SMILES | C=CCn1cc(C(O)(c2ccc3c(cnn3-c3ccc(F)cc3)c2)C(F)(F)F)c2ccc(N3CCCC3)cc21 |
| InChI | InChI=1S/C30H26F4N4O/c1-2-13-37-19-26(25-11-10-24(17-28(25)37)36-14-3-4-15-36)29(39,30(32,33)34)21-5-12-27-20(16-21)18-35-38(27)23-8-6-22(31)7-9-23/h2,5-12,16-19,39H,1,3-4,13-15H2 |
| InChIKey | VJUQMUOHGMSPNH-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 46.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.56 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|