C26H18BrF4N3O — CID 24957617
1-(6-bromo-1-prop-2-enylindol-3-yl)-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanol (PubChem CID 24957617) has the molecular formula C26H18BrF4N3O and a molecular weight of 544.35 g/mol. Its IUPAC name is 1-(6-bromo-1-prop-2-enylindol-3-yl)-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanol.
| Compound Name | 1-(6-bromo-1-prop-2-enylindol-3-yl)-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanol |
|---|---|
| PubChem CID | 24957617 |
| Molecular Formula | C26H18BrF4N3O |
| Molecular Weight | 544.35 g/mol |
| Exact Mass | 543.06 |
| IUPAC Name | 1-(6-bromo-1-prop-2-enylindol-3-yl)-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanol |
| SMILES | C=CCn1cc(C(O)(c2ccc3c(cnn3-c3ccc(F)cc3)c2)C(F)(F)F)c2ccc(Br)cc21 |
| InChI | InChI=1S/C26H18BrF4N3O/c1-2-11-33-15-22(21-9-4-18(27)13-24(21)33)25(35,26(29,30)31)17-3-10-23-16(12-17)14-32-34(23)20-7-5-19(28)6-8-20/h2-10,12-15,35H,1,11H2 |
| InChIKey | WERPBGQVCMVVSX-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 42.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.35 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|