C21H16N6 — CID 24957630
2-(3-aminophenyl)-4-(1H-indazol-5-yl)-6-methyl-1,4-dihydropyridine-3,5-dicarbonitrile (PubChem CID 24957630) has the molecular formula C21H16N6 and a molecular weight of 352.40 g/mol. Its IUPAC name is 2-(3-aminophenyl)-4-(1H-indazol-5-yl)-6-methyl-1,4-dihydropyridine-3,5-dicarbonitrile.
| Compound Name | 2-(3-aminophenyl)-4-(1H-indazol-5-yl)-6-methyl-1,4-dihydropyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 24957630 |
| Molecular Formula | C21H16N6 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-(3-aminophenyl)-4-(1H-indazol-5-yl)-6-methyl-1,4-dihydropyridine-3,5-dicarbonitrile |
| SMILES | CC1=C(C#N)C(c2ccc3[nH]ncc3c2)C(C#N)=C(c2cccc(N)c2)N1 |
| InChI | InChI=1S/C21H16N6/c1-12-17(9-22)20(13-5-6-19-15(7-13)11-25-27-19)18(10-23)21(26-12)14-3-2-4-16(24)8-14/h2-8,11,20,26H,24H2,1H3,(H,25,27) |
| InChIKey | AIYJEAJRRSHAAW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 114.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|