About 5-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-6-methoxyisoquinolin-1-amine
5-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-6-methoxyisoquinolin-1-amine (PubChem CID 24958040) has the molecular formula C20H19Cl2N3O2
and a molecular weight of 404.30 g/mol. Its IUPAC name is 5-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-6-methoxyisoquinolin-1-amine.
Molecular Properties
| Compound Name | 5-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-6-methoxyisoquinolin-1-amine |
| PubChem CID | 24958040 |
| Molecular Formula | C20H19Cl2N3O2 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 5-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-6-methoxyisoquinolin-1-amine |
| SMILES | COc1ccc2c(Nc3c(Cl)cncc3Cl)nccc2c1OC1CCCC1 |
| InChI | InChI=1S/C20H19Cl2N3O2/c1-26-17-7-6-14-13(19(17)27-12-4-2-3-5-12)8-9-24-20(14)25-18-15(21)10-23-11-16(18)22/h6-12H,2-5H2,1H3,(H,23,24,25) |
| InChIKey | PHIWHTOIEFIDDA-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-6-methoxyisoquinolin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-6-methoxyisoquinolin-1-amine?
The IUPAC name of 5-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-6-methoxyisoquinolin-1-amine (CID 24958040) is 5-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-6-methoxyisoquinolin-1-amine.
What is the SMILES notation for 5-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-6-methoxyisoquinolin-1-amine?
The canonical SMILES for 5-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-6-methoxyisoquinolin-1-amine is COc1ccc2c(Nc3c(Cl)cncc3Cl)nccc2c1OC1CCCC1.
What is the InChIKey of 5-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-6-methoxyisoquinolin-1-amine?
The InChIKey is PHIWHTOIEFIDDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19Cl2N3O2/c1-26-17-7-6-14-13(19(17)27-12-4-2-3-5-12)8-9-24-20(14)25-18-15(21)10-23-11-16(18)22/h6-12H,2-5H2,1H3,(H,23,24,25).
What are the key properties of 5-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-6-methoxyisoquinolin-1-amine?
5-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-6-methoxyisoquinolin-1-amine has a molecular weight of 404.30 g/mol, XLogP of 6.01, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopentyloxy-N-(3,5-dichloro-4-pyridinyl)-6-methoxyisoquinolin-1-amine is sourced from PubChem (CID 24958040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).