About 8-(2-aminoethyl)-5-hydroxy-4H-1,4-benzoxazin-3-one
8-(2-aminoethyl)-5-hydroxy-4H-1,4-benzoxazin-3-one (PubChem CID 24958535) has the molecular formula C10H12N2O3
and a molecular weight of 208.22 g/mol. Its IUPAC name is 8-(2-aminoethyl)-5-hydroxy-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 8-(2-aminoethyl)-5-hydroxy-4H-1,4-benzoxazin-3-one |
| PubChem CID | 24958535 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 8-(2-aminoethyl)-5-hydroxy-4H-1,4-benzoxazin-3-one |
| SMILES | NCCc1ccc(O)c2c1OCC(=O)N2 |
| InChI | InChI=1S/C10H12N2O3/c11-4-3-6-1-2-7(13)9-10(6)15-5-8(14)12-9/h1-2,13H,3-5,11H2,(H,12,14) |
| InChIKey | OPXPMMZQJSTLNY-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 8-(2-aminoethyl)-5-hydroxy-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2-aminoethyl)-5-hydroxy-4H-1,4-benzoxazin-3-one?
The IUPAC name of 8-(2-aminoethyl)-5-hydroxy-4H-1,4-benzoxazin-3-one (CID 24958535) is 8-(2-aminoethyl)-5-hydroxy-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 8-(2-aminoethyl)-5-hydroxy-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 8-(2-aminoethyl)-5-hydroxy-4H-1,4-benzoxazin-3-one is NCCc1ccc(O)c2c1OCC(=O)N2.
What is the InChIKey of 8-(2-aminoethyl)-5-hydroxy-4H-1,4-benzoxazin-3-one?
The InChIKey is OPXPMMZQJSTLNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O3/c11-4-3-6-1-2-7(13)9-10(6)15-5-8(14)12-9/h1-2,13H,3-5,11H2,(H,12,14).
What are the key properties of 8-(2-aminoethyl)-5-hydroxy-4H-1,4-benzoxazin-3-one?
8-(2-aminoethyl)-5-hydroxy-4H-1,4-benzoxazin-3-one has a molecular weight of 208.22 g/mol, XLogP of 0.22, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2-aminoethyl)-5-hydroxy-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 24958535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).