C23H18F4N4O2 — CID 24958732
1-prop-2-enyl-4-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]pyrrole-2-carboxamide (PubChem CID 24958732) has the molecular formula C23H18F4N4O2 and a molecular weight of 458.42 g/mol. Its IUPAC name is 1-prop-2-enyl-4-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]pyrrole-2-carboxamide.
| Compound Name | 1-prop-2-enyl-4-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 24958732 |
| Molecular Formula | C23H18F4N4O2 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 1-prop-2-enyl-4-[2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]-1-hydroxyethyl]pyrrole-2-carboxamide |
| SMILES | C=CCn1cc(C(O)(c2ccc3c(cnn3-c3ccc(F)cc3)c2)C(F)(F)F)cc1C(N)=O |
| InChI | InChI=1S/C23H18F4N4O2/c1-2-9-30-13-16(11-20(30)21(28)32)22(33,23(25,26)27)15-3-8-19-14(10-15)12-29-31(19)18-6-4-17(24)5-7-18/h2-8,10-13,33H,1,9H2,(H2,28,32) |
| InChIKey | WBIBYZORRNIRDP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 86.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|