C21H29N5O2 — CID 24959088
(9R,10R)-9-hydroxy-10-[4-(1,3,5-trimethylpyrazol-4-yl)butan-2-ylamino]-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one (PubChem CID 24959088) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is (9R,10R)-9-hydroxy-10-[4-(1,3,5-trimethylpyrazol-4-yl)butan-2-ylamino]-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one.
| Compound Name | (9R,10R)-9-hydroxy-10-[4-(1,3,5-trimethylpyrazol-4-yl)butan-2-ylamino]-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one |
|---|---|
| PubChem CID | 24959088 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | (9R,10R)-9-hydroxy-10-[4-(1,3,5-trimethylpyrazol-4-yl)butan-2-ylamino]-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one |
| SMILES | Cc1nn(C)c(C)c1CCC(C)N[C@@H]1CCn2c(=O)[nH]c3cccc(c32)[C@H]1O |
| InChI | InChI=1S/C21H29N5O2/c1-12(8-9-15-13(2)24-25(4)14(15)3)22-18-10-11-26-19-16(20(18)27)6-5-7-17(19)23-21(26)28/h5-7,12,18,20,22,27H,8-11H2,1-4H3,(H,23,28)/t12?,18-,20-/m1/s1 |
| InChIKey | BNLBXHNIVFAZSB-WJTMUZSXSA-N |
| XLogP | 2.10 |
| TPSA | 87.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |