C22H13ClF4N4O — CID 24959089
1-(7-chloro-1H-pyrrolo[2,3-c]pyridin-3-yl)-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanol (PubChem CID 24959089) has the molecular formula C22H13ClF4N4O and a molecular weight of 460.82 g/mol. Its IUPAC name is 1-(7-chloro-1H-pyrrolo[2,3-c]pyridin-3-yl)-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanol.
| Compound Name | 1-(7-chloro-1H-pyrrolo[2,3-c]pyridin-3-yl)-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanol |
|---|---|
| PubChem CID | 24959089 |
| Molecular Formula | C22H13ClF4N4O |
| Molecular Weight | 460.82 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | 1-(7-chloro-1H-pyrrolo[2,3-c]pyridin-3-yl)-2,2,2-trifluoro-1-[1-(4-fluorophenyl)indazol-5-yl]ethanol |
| SMILES | OC(c1ccc2c(cnn2-c2ccc(F)cc2)c1)(c1c[nH]c2c(Cl)nccc12)C(F)(F)F |
| InChI | InChI=1S/C22H13ClF4N4O/c23-20-19-16(7-8-28-20)17(11-29-19)21(32,22(25,26)27)13-1-6-18-12(9-13)10-30-31(18)15-4-2-14(24)3-5-15/h1-11,29,32H |
| InChIKey | DVNPQRWOEFQUFY-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.82 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|