About 1,3-benzodioxol-4-yl(spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)methanone
1,3-benzodioxol-4-yl(spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)methanone (PubChem CID 24959191) has the molecular formula C20H19NO4
and a molecular weight of 337.38 g/mol. Its IUPAC name is 1,3-benzodioxol-4-yl(spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)methanone.
Molecular Properties
| Compound Name | 1,3-benzodioxol-4-yl(spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)methanone |
| PubChem CID | 24959191 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 1,3-benzodioxol-4-yl(spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)methanone |
| SMILES | O=C(c1cccc2c1OCO2)N1CCC2(CC1)OCc1ccccc12 |
| InChI | InChI=1S/C20H19NO4/c22-19(15-5-3-7-17-18(15)24-13-23-17)21-10-8-20(9-11-21)16-6-2-1-4-14(16)12-25-20/h1-7H,8-13H2 |
| InChIKey | YQULIJPJWZAEEZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-benzodioxol-4-yl(spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzodioxol-4-yl(spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)methanone?
The IUPAC name of 1,3-benzodioxol-4-yl(spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)methanone (CID 24959191) is 1,3-benzodioxol-4-yl(spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)methanone.
What is the SMILES notation for 1,3-benzodioxol-4-yl(spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)methanone?
The canonical SMILES for 1,3-benzodioxol-4-yl(spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)methanone is O=C(c1cccc2c1OCO2)N1CCC2(CC1)OCc1ccccc12.
What is the InChIKey of 1,3-benzodioxol-4-yl(spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)methanone?
The InChIKey is YQULIJPJWZAEEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO4/c22-19(15-5-3-7-17-18(15)24-13-23-17)21-10-8-20(9-11-21)16-6-2-1-4-14(16)12-25-20/h1-7H,8-13H2.
What are the key properties of 1,3-benzodioxol-4-yl(spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)methanone?
1,3-benzodioxol-4-yl(spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)methanone has a molecular weight of 337.38 g/mol, XLogP of 3.08, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzodioxol-4-yl(spiro[1H-2-benzofuran-3,4'-piperidine]-1'-yl)methanone is sourced from PubChem (CID 24959191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).