C15H11F3N4OS — CID 2495922
2-[methyl(thieno[2,3-d]pyrimidin-4-yl)amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 2495922) has the molecular formula C15H11F3N4OS and a molecular weight of 352.34 g/mol. Its IUPAC name is 2-[methyl(thieno[2,3-d]pyrimidin-4-yl)amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[methyl(thieno[2,3-d]pyrimidin-4-yl)amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 2495922 |
| Molecular Formula | C15H11F3N4OS |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 2-[methyl(thieno[2,3-d]pyrimidin-4-yl)amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccc(F)c(F)c1F)c1ncnc2sccc12 |
| InChI | InChI=1S/C15H11F3N4OS/c1-22(14-8-4-5-24-15(8)20-7-19-14)6-11(23)21-10-3-2-9(16)12(17)13(10)18/h2-5,7H,6H2,1H3,(H,21,23) |
| InChIKey | RSJWUYLERTWXEP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|