C18H22N4O2S — CID 24959448
(9R,10R)-9-hydroxy-10-[[(2S)-4-(1,2-thiazol-4-yl)butan-2-yl]amino]-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one (PubChem CID 24959448) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is (9R,10R)-9-hydroxy-10-[[(2S)-4-(1,2-thiazol-4-yl)butan-2-yl]amino]-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one.
| Compound Name | (9R,10R)-9-hydroxy-10-[[(2S)-4-(1,2-thiazol-4-yl)butan-2-yl]amino]-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one |
|---|---|
| PubChem CID | 24959448 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (9R,10R)-9-hydroxy-10-[[(2S)-4-(1,2-thiazol-4-yl)butan-2-yl]amino]-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one |
| SMILES | C[C@@H](CCc1cnsc1)N[C@@H]1CCn2c(=O)[nH]c3cccc(c32)[C@H]1O |
| InChI | InChI=1S/C18H22N4O2S/c1-11(5-6-12-9-19-25-10-12)20-15-7-8-22-16-13(17(15)23)3-2-4-14(16)21-18(22)24/h2-4,9-11,15,17,20,23H,5-8H2,1H3,(H,21,24)/t11-,15+,17+/m0/s1 |
| InChIKey | HEQBCCJXCCPPLU-UXEPBGEESA-N |
| XLogP | 2.20 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |