C23H23N3O3 — CID 24959542
(E)-N-hydroxy-3-[2-[2-(3-methyl-5-phenyl-1,2-oxazol-4-yl)ethyl]-1,3-dihydroisoindol-5-yl]prop-2-enamide (PubChem CID 24959542) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[2-[2-(3-methyl-5-phenyl-1,2-oxazol-4-yl)ethyl]-1,3-dihydroisoindol-5-yl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[2-[2-(3-methyl-5-phenyl-1,2-oxazol-4-yl)ethyl]-1,3-dihydroisoindol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 24959542 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | (E)-N-hydroxy-3-[2-[2-(3-methyl-5-phenyl-1,2-oxazol-4-yl)ethyl]-1,3-dihydroisoindol-5-yl]prop-2-enamide |
| SMILES | Cc1noc(-c2ccccc2)c1CCN1Cc2ccc(/C=C/C(=O)NO)cc2C1 |
| InChI | InChI=1S/C23H23N3O3/c1-16-21(23(29-25-16)18-5-3-2-4-6-18)11-12-26-14-19-9-7-17(13-20(19)15-26)8-10-22(27)24-28/h2-10,13,28H,11-12,14-15H2,1H3,(H,24,27)/b10-8+ |
| InChIKey | HWQAGUZDIUBZJD-CSKARUKUSA-N |
| XLogP | 3.73 |
| TPSA | 78.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|