C19H19F3O8S — CID 24959805
(1,2,3,9-tetramethoxy-5,7-dihydrobenzo[d][2]benzoxepin-8-yl) trifluoromethanesulfonate (PubChem CID 24959805) has the molecular formula C19H19F3O8S and a molecular weight of 464.41 g/mol. Its IUPAC name is (1,2,3,9-tetramethoxy-5,7-dihydrobenzo[d][2]benzoxepin-8-yl) trifluoromethanesulfonate.
| Compound Name | (1,2,3,9-tetramethoxy-5,7-dihydrobenzo[d][2]benzoxepin-8-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 24959805 |
| Molecular Formula | C19H19F3O8S |
| Molecular Weight | 464.41 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | (1,2,3,9-tetramethoxy-5,7-dihydrobenzo[d][2]benzoxepin-8-yl) trifluoromethanesulfonate |
| SMILES | COc1ccc2c(c1OS(=O)(=O)C(F)(F)F)COCc1cc(OC)c(OC)c(OC)c1-2 |
| InChI | InChI=1S/C19H19F3O8S/c1-25-13-6-5-11-12(16(13)30-31(23,24)19(20,21)22)9-29-8-10-7-14(26-2)17(27-3)18(28-4)15(10)11/h5-7H,8-9H2,1-4H3 |
| InChIKey | JYFGIACZMDHOCH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|