C29H25F4N3O3 — CID 24959818
1-[1-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]indol-3-yl]-2,2,2-trifluoro-1-[3-(4-fluorophenyl)imidazo[1,5-a]pyridin-7-yl]ethanol (PubChem CID 24959818) has the molecular formula C29H25F4N3O3 and a molecular weight of 539.53 g/mol. Its IUPAC name is 1-[1-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]indol-3-yl]-2,2,2-trifluoro-1-[3-(4-fluorophenyl)imidazo[1,5-a]pyridin-7-yl]ethanol.
| Compound Name | 1-[1-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]indol-3-yl]-2,2,2-trifluoro-1-[3-(4-fluorophenyl)imidazo[1,5-a]pyridin-7-yl]ethanol |
|---|---|
| PubChem CID | 24959818 |
| Molecular Formula | C29H25F4N3O3 |
| Molecular Weight | 539.53 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | 1-[1-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]indol-3-yl]-2,2,2-trifluoro-1-[3-(4-fluorophenyl)imidazo[1,5-a]pyridin-7-yl]ethanol |
| SMILES | CC1(C)OCC(Cn2cc(C(O)(c3ccn4c(-c5ccc(F)cc5)ncc4c3)C(F)(F)F)c3ccccc32)O1 |
| InChI | InChI=1S/C29H25F4N3O3/c1-27(2)38-17-22(39-27)15-35-16-24(23-5-3-4-6-25(23)35)28(37,29(31,32)33)19-11-12-36-21(13-19)14-34-26(36)18-7-9-20(30)10-8-18/h3-14,16,22,37H,15,17H2,1-2H3 |
| InChIKey | RANSLLPENJTIPL-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 60.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.53 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |