C24H23Cl2NO4 — CID 24959954
2-(3,5-dichloro-4-pyridinyl)-1-[3,4-dimethoxy-2-(3-phenylpropoxy)phenyl]ethanone (PubChem CID 24959954) has the molecular formula C24H23Cl2NO4 and a molecular weight of 460.36 g/mol. Its IUPAC name is 2-(3,5-dichloro-4-pyridinyl)-1-[3,4-dimethoxy-2-(3-phenylpropoxy)phenyl]ethanone.
| Compound Name | 2-(3,5-dichloro-4-pyridinyl)-1-[3,4-dimethoxy-2-(3-phenylpropoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 24959954 |
| Molecular Formula | C24H23Cl2NO4 |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 2-(3,5-dichloro-4-pyridinyl)-1-[3,4-dimethoxy-2-(3-phenylpropoxy)phenyl]ethanone |
| SMILES | COc1ccc(C(=O)Cc2c(Cl)cncc2Cl)c(OCCCc2ccccc2)c1OC |
| InChI | InChI=1S/C24H23Cl2NO4/c1-29-22-11-10-17(21(28)13-18-19(25)14-27-15-20(18)26)23(24(22)30-2)31-12-6-9-16-7-4-3-5-8-16/h3-5,7-8,10-11,14-15H,6,9,12-13H2,1-2H3 |
| InChIKey | KOHXGYZDGINMGH-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|