C22H23Cl2FN4O — CID 24960023
3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-methyl-5-(1-piperidin-4-ylpyrazol-4-yl)pyridine (PubChem CID 24960023) has the molecular formula C22H23Cl2FN4O and a molecular weight of 449.36 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-methyl-5-(1-piperidin-4-ylpyrazol-4-yl)pyridine.
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-methyl-5-(1-piperidin-4-ylpyrazol-4-yl)pyridine |
|---|---|
| PubChem CID | 24960023 |
| Molecular Formula | C22H23Cl2FN4O |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-methyl-5-(1-piperidin-4-ylpyrazol-4-yl)pyridine |
| SMILES | Cc1ncc(-c2cnn(C3CCNCC3)c2)cc1OC(C)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C22H23Cl2FN4O/c1-13-20(30-14(2)21-18(23)3-4-19(25)22(21)24)9-15(10-27-13)16-11-28-29(12-16)17-5-7-26-8-6-17/h3-4,9-12,14,17,26H,5-8H2,1-2H3 |
| InChIKey | KUTAVGJSWMKFCZ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|