About N-benzyl-2-(3-benzyl-1,2-oxazol-5-yl)-4-methyl-1,3-thiazole-5-carboxamide
N-benzyl-2-(3-benzyl-1,2-oxazol-5-yl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 24960062) has the molecular formula C22H19N3O2S
and a molecular weight of 389.48 g/mol. Its IUPAC name is N-benzyl-2-(3-benzyl-1,2-oxazol-5-yl)-4-methyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-benzyl-2-(3-benzyl-1,2-oxazol-5-yl)-4-methyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 24960062 |
| Molecular Formula | C22H19N3O2S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-benzyl-2-(3-benzyl-1,2-oxazol-5-yl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2cc(Cc3ccccc3)no2)sc1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C22H19N3O2S/c1-15-20(21(26)23-14-17-10-6-3-7-11-17)28-22(24-15)19-13-18(25-27-19)12-16-8-4-2-5-9-16/h2-11,13H,12,14H2,1H3,(H,23,26) |
| InChIKey | VVCCFRMGZHTIFG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-benzyl-2-(3-benzyl-1,2-oxazol-5-yl)-4-methyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-(3-benzyl-1,2-oxazol-5-yl)-4-methyl-1,3-thiazole-5-carboxamide?
The IUPAC name of N-benzyl-2-(3-benzyl-1,2-oxazol-5-yl)-4-methyl-1,3-thiazole-5-carboxamide (CID 24960062) is N-benzyl-2-(3-benzyl-1,2-oxazol-5-yl)-4-methyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-benzyl-2-(3-benzyl-1,2-oxazol-5-yl)-4-methyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-benzyl-2-(3-benzyl-1,2-oxazol-5-yl)-4-methyl-1,3-thiazole-5-carboxamide is Cc1nc(-c2cc(Cc3ccccc3)no2)sc1C(=O)NCc1ccccc1.
What is the InChIKey of N-benzyl-2-(3-benzyl-1,2-oxazol-5-yl)-4-methyl-1,3-thiazole-5-carboxamide?
The InChIKey is VVCCFRMGZHTIFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3O2S/c1-15-20(21(26)23-14-17-10-6-3-7-11-17)28-22(24-15)19-13-18(25-27-19)12-16-8-4-2-5-9-16/h2-11,13H,12,14H2,1H3,(H,23,26).
What are the key properties of N-benzyl-2-(3-benzyl-1,2-oxazol-5-yl)-4-methyl-1,3-thiazole-5-carboxamide?
N-benzyl-2-(3-benzyl-1,2-oxazol-5-yl)-4-methyl-1,3-thiazole-5-carboxamide has a molecular weight of 389.48 g/mol, XLogP of 4.63, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-(3-benzyl-1,2-oxazol-5-yl)-4-methyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 24960062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).