C23H24N4O2 — CID 24960283
(E)-N-hydroxy-3-[2-[2-(5-phenyl-1H-pyrazol-4-yl)ethyl]-3,4-dihydro-1H-isoquinolin-7-yl]prop-2-enamide (PubChem CID 24960283) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[2-[2-(5-phenyl-1H-pyrazol-4-yl)ethyl]-3,4-dihydro-1H-isoquinolin-7-yl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[2-[2-(5-phenyl-1H-pyrazol-4-yl)ethyl]-3,4-dihydro-1H-isoquinolin-7-yl]prop-2-enamide |
|---|---|
| PubChem CID | 24960283 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | (E)-N-hydroxy-3-[2-[2-(5-phenyl-1H-pyrazol-4-yl)ethyl]-3,4-dihydro-1H-isoquinolin-7-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)CN(CCc1cn[nH]c1-c1ccccc1)CC2)NO |
| InChI | InChI=1S/C23H24N4O2/c28-22(26-29)9-7-17-6-8-18-10-12-27(16-21(18)14-17)13-11-20-15-24-25-23(20)19-4-2-1-3-5-19/h1-9,14-15,29H,10-13,16H2,(H,24,25)(H,26,28)/b9-7+ |
| InChIKey | LIWDGTAEDVCKPA-VQHVLOKHSA-N |
| XLogP | 3.20 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|