About 2-(3,5-dihydroxyphenyl)-7-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]chromen-4-one
2-(3,5-dihydroxyphenyl)-7-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]chromen-4-one (PubChem CID 24960482) has the molecular formula C21H23NO6
and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-(3,5-dihydroxyphenyl)-7-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]chromen-4-one.
Molecular Properties
| Compound Name | 2-(3,5-dihydroxyphenyl)-7-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]chromen-4-one |
| PubChem CID | 24960482 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 2-(3,5-dihydroxyphenyl)-7-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]chromen-4-one |
| SMILES | CC(C)NC[C@H](O)COc1ccc2c(=O)cc(-c3cc(O)cc(O)c3)oc2c1 |
| InChI | InChI=1S/C21H23NO6/c1-12(2)22-10-16(25)11-27-17-3-4-18-19(26)9-20(28-21(18)8-17)13-5-14(23)7-15(24)6-13/h3-9,12,16,22-25H,10-11H2,1-2H3/t16-/m0/s1 |
| InChIKey | NGUOSJCZPQFPPX-INIZCTEOSA-N |
| XLogP | 2.61 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(3,5-dihydroxyphenyl)-7-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dihydroxyphenyl)-7-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]chromen-4-one?
The IUPAC name of 2-(3,5-dihydroxyphenyl)-7-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]chromen-4-one (CID 24960482) is 2-(3,5-dihydroxyphenyl)-7-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]chromen-4-one.
What is the SMILES notation for 2-(3,5-dihydroxyphenyl)-7-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]chromen-4-one?
The canonical SMILES for 2-(3,5-dihydroxyphenyl)-7-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]chromen-4-one is CC(C)NC[C@H](O)COc1ccc2c(=O)cc(-c3cc(O)cc(O)c3)oc2c1.
What is the InChIKey of 2-(3,5-dihydroxyphenyl)-7-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]chromen-4-one?
The InChIKey is NGUOSJCZPQFPPX-INIZCTEOSA-N. The full InChI is InChI=1S/C21H23NO6/c1-12(2)22-10-16(25)11-27-17-3-4-18-19(26)9-20(28-21(18)8-17)13-5-14(23)7-15(24)6-13/h3-9,12,16,22-25H,10-11H2,1-2H3/t16-/m0/s1.
What are the key properties of 2-(3,5-dihydroxyphenyl)-7-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]chromen-4-one?
2-(3,5-dihydroxyphenyl)-7-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]chromen-4-one has a molecular weight of 385.42 g/mol, XLogP of 2.61, 7 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dihydroxyphenyl)-7-[(2S)-2-hydroxy-3-(propan-2-ylamino)propoxy]chromen-4-one is sourced from PubChem (CID 24960482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).