C15H19BClNO2 — CID 24960595
5-chloro-2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (PubChem CID 24960595) has the molecular formula C15H19BClNO2 and a molecular weight of 291.59 g/mol. Its IUPAC name is 5-chloro-2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole.
| Compound Name | 5-chloro-2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
|---|---|
| PubChem CID | 24960595 |
| Molecular Formula | C15H19BClNO2 |
| Molecular Weight | 291.59 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 5-chloro-2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| SMILES | Cc1cc2cc(Cl)cc(B3OC(C)(C)C(C)(C)O3)c2[nH]1 |
| InChI | InChI=1S/C15H19BClNO2/c1-9-6-10-7-11(17)8-12(13(10)18-9)16-19-14(2,3)15(4,5)20-16/h6-8,18H,1-5H3 |
| InChIKey | CZGYEJPYWNMRCD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.59 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|