About 7-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]-3-(4-hydroxyphenyl)chromen-4-one
7-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]-3-(4-hydroxyphenyl)chromen-4-one (PubChem CID 24960630) has the molecular formula C24H15FN2O5
and a molecular weight of 430.39 g/mol. Its IUPAC name is 7-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]-3-(4-hydroxyphenyl)chromen-4-one.
Molecular Properties
| Compound Name | 7-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]-3-(4-hydroxyphenyl)chromen-4-one |
| PubChem CID | 24960630 |
| Molecular Formula | C24H15FN2O5 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 7-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]-3-(4-hydroxyphenyl)chromen-4-one |
| SMILES | O=c1c(-c2ccc(O)cc2)coc2cc(OCc3nnc(-c4cccc(F)c4)o3)ccc12 |
| InChI | InChI=1S/C24H15FN2O5/c25-16-3-1-2-15(10-16)24-27-26-22(32-24)13-30-18-8-9-19-21(11-18)31-12-20(23(19)29)14-4-6-17(28)7-5-14/h1-12,28H,13H2 |
| InChIKey | BPVYYYUTPWPBES-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 98.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]-3-(4-hydroxyphenyl)chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]-3-(4-hydroxyphenyl)chromen-4-one?
The IUPAC name of 7-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]-3-(4-hydroxyphenyl)chromen-4-one (CID 24960630) is 7-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]-3-(4-hydroxyphenyl)chromen-4-one.
What is the SMILES notation for 7-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]-3-(4-hydroxyphenyl)chromen-4-one?
The canonical SMILES for 7-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]-3-(4-hydroxyphenyl)chromen-4-one is O=c1c(-c2ccc(O)cc2)coc2cc(OCc3nnc(-c4cccc(F)c4)o3)ccc12.
What is the InChIKey of 7-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]-3-(4-hydroxyphenyl)chromen-4-one?
The InChIKey is BPVYYYUTPWPBES-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H15FN2O5/c25-16-3-1-2-15(10-16)24-27-26-22(32-24)13-30-18-8-9-19-21(11-18)31-12-20(23(19)29)14-4-6-17(28)7-5-14/h1-12,28H,13H2.
What are the key properties of 7-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]-3-(4-hydroxyphenyl)chromen-4-one?
7-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]-3-(4-hydroxyphenyl)chromen-4-one has a molecular weight of 430.39 g/mol, XLogP of 4.93, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]-3-(4-hydroxyphenyl)chromen-4-one is sourced from PubChem (CID 24960630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).