C23H25N3O — CID 24961057
6-imidazo[1,2-a]pyridin-5-yl-2,2,4,4-tetramethyl-1,7,8,9-tetrahydrocyclopenta[h]quinolin-3-one (PubChem CID 24961057) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is 6-imidazo[1,2-a]pyridin-5-yl-2,2,4,4-tetramethyl-1,7,8,9-tetrahydrocyclopenta[h]quinolin-3-one.
| Compound Name | 6-imidazo[1,2-a]pyridin-5-yl-2,2,4,4-tetramethyl-1,7,8,9-tetrahydrocyclopenta[h]quinolin-3-one |
|---|---|
| PubChem CID | 24961057 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 6-imidazo[1,2-a]pyridin-5-yl-2,2,4,4-tetramethyl-1,7,8,9-tetrahydrocyclopenta[h]quinolin-3-one |
| SMILES | CC1(C)Nc2c(cc(-c3cccc4nccn34)c3c2CCC3)C(C)(C)C1=O |
| InChI | InChI=1S/C23H25N3O/c1-22(2)17-13-16(18-9-6-10-19-24-11-12-26(18)19)14-7-5-8-15(14)20(17)25-23(3,4)21(22)27/h6,9-13,25H,5,7-8H2,1-4H3 |
| InChIKey | NULJELQRMSFKRP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |