C22H16F4N4O — CID 24961117
4-ethoxy-6-(4-fluorophenyl)-N-[(2,3,4-trifluorophenyl)methyl]pyrido[3,2-d]pyrimidin-2-amine (PubChem CID 24961117) has the molecular formula C22H16F4N4O and a molecular weight of 428.39 g/mol. Its IUPAC name is 4-ethoxy-6-(4-fluorophenyl)-N-[(2,3,4-trifluorophenyl)methyl]pyrido[3,2-d]pyrimidin-2-amine.
| Compound Name | 4-ethoxy-6-(4-fluorophenyl)-N-[(2,3,4-trifluorophenyl)methyl]pyrido[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 24961117 |
| Molecular Formula | C22H16F4N4O |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 4-ethoxy-6-(4-fluorophenyl)-N-[(2,3,4-trifluorophenyl)methyl]pyrido[3,2-d]pyrimidin-2-amine |
| SMILES | CCOc1nc(NCc2ccc(F)c(F)c2F)nc2ccc(-c3ccc(F)cc3)nc12 |
| InChI | InChI=1S/C22H16F4N4O/c1-2-31-21-20-17(10-9-16(28-20)12-3-6-14(23)7-4-12)29-22(30-21)27-11-13-5-8-15(24)19(26)18(13)25/h3-10H,2,11H2,1H3,(H,27,29,30) |
| InChIKey | GNPHAAVRFJTVPR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|