C14H13Cl2FN4O2 — CID 24961495
6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-methylpyridazine-3-carboxamide (PubChem CID 24961495) has the molecular formula C14H13Cl2FN4O2 and a molecular weight of 359.19 g/mol. Its IUPAC name is 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-methylpyridazine-3-carboxamide.
| Compound Name | 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-methylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 24961495 |
| Molecular Formula | C14H13Cl2FN4O2 |
| Molecular Weight | 359.19 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-methylpyridazine-3-carboxamide |
| SMILES | CNC(=O)c1cc(OC(C)c2c(Cl)ccc(F)c2Cl)c(N)nn1 |
| InChI | InChI=1S/C14H13Cl2FN4O2/c1-6(11-7(15)3-4-8(17)12(11)16)23-10-5-9(14(22)19-2)20-21-13(10)18/h3-6H,1-2H3,(H2,18,21)(H,19,22) |
| InChIKey | OVKBKUAFDDPMMT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.19 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|