C28H22N4O2S — CID 24961935
4-[2-(5-anilino-1,3,4-thiadiazol-2-yl)phenoxy]-N-methyl-N-phenylbenzamide (PubChem CID 24961935) has the molecular formula C28H22N4O2S and a molecular weight of 478.58 g/mol. Its IUPAC name is 4-[2-(5-anilino-1,3,4-thiadiazol-2-yl)phenoxy]-N-methyl-N-phenylbenzamide.
| Compound Name | 4-[2-(5-anilino-1,3,4-thiadiazol-2-yl)phenoxy]-N-methyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 24961935 |
| Molecular Formula | C28H22N4O2S |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 4-[2-(5-anilino-1,3,4-thiadiazol-2-yl)phenoxy]-N-methyl-N-phenylbenzamide |
| SMILES | CN(C(=O)c1ccc(Oc2ccccc2-c2nnc(Nc3ccccc3)s2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H22N4O2S/c1-32(22-12-6-3-7-13-22)27(33)20-16-18-23(19-17-20)34-25-15-9-8-14-24(25)26-30-31-28(35-26)29-21-10-4-2-5-11-21/h2-19H,1H3,(H,29,31) |
| InChIKey | PYKFXBPJXXKHTQ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |